About 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one
2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one (PubChem CID 174585226) has the molecular formula C17H15ClO4
and a molecular weight of 318.76 g/mol. Its IUPAC name is 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one.
Molecular Properties
| Compound Name | 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one |
| PubChem CID | 174585226 |
| Molecular Formula | C17H15ClO4 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one |
| SMILES | Cc1c(O)c(C)c2c(c1O)C(=O)CC(Cl)(c1ccccc1)O2 |
| InChI | InChI=1S/C17H15ClO4/c1-9-14(20)10(2)16-13(15(9)21)12(19)8-17(18,22-16)11-6-4-3-5-7-11/h3-7,20-21H,8H2,1-2H3 |
| InChIKey | BYTPMUXMMRLMOF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one?
The IUPAC name of 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one (CID 174585226) is 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one.
What is the SMILES notation for 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one?
The canonical SMILES for 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one is Cc1c(O)c(C)c2c(c1O)C(=O)CC(Cl)(c1ccccc1)O2.
What is the InChIKey of 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one?
The InChIKey is BYTPMUXMMRLMOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15ClO4/c1-9-14(20)10(2)16-13(15(9)21)12(19)8-17(18,22-16)11-6-4-3-5-7-11/h3-7,20-21H,8H2,1-2H3.
What are the key properties of 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one?
2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one has a molecular weight of 318.76 g/mol, XLogP of 3.77, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5,7-dihydroxy-6,8-dimethyl-2-phenyl-3H-chromen-4-one is sourced from PubChem (CID 174585226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).