C17H24F2O5S — CID 174585262
methoxycarbonyl difluoromethanesulfonate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane (PubChem CID 174585262) has the molecular formula C17H24F2O5S and a molecular weight of 378.44 g/mol. Its IUPAC name is methoxycarbonyl difluoromethanesulfonate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane.
| Compound Name | methoxycarbonyl difluoromethanesulfonate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
|---|---|
| PubChem CID | 174585262 |
| Molecular Formula | C17H24F2O5S |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | methoxycarbonyl difluoromethanesulfonate;pentacyclo[7.3.1.14,12.02,7.06,11]tetradecane |
| SMILES | C1C2CC3C4CC5CC(C14)C(C2)C3C5.COC(=O)OS(=O)(=O)C(F)F |
| InChI | InChI=1S/C14H20.C3H4F2O5S/c1-7-2-12-10-4-8-5-11(9(1)10)13(3-7)14(12)6-8;1-9-3(6)10-11(7,8)2(4)5/h7-14H,1-6H2;2H,1H3 |
| InChIKey | OXDRMDRJIBKDRZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|