About dimethoxy(oxo)phosphanium;hydron
dimethoxy(oxo)phosphanium;hydron (PubChem CID 174585571) has the molecular formula C2H7O3P+2
and a molecular weight of 110.05 g/mol. Its IUPAC name is dimethoxy(oxo)phosphanium;hydron.
Molecular Properties
| Compound Name | dimethoxy(oxo)phosphanium;hydron |
| PubChem CID | 174585571 |
| Molecular Formula | C2H7O3P+2 |
| Molecular Weight | 110.05 g/mol |
| Exact Mass | 110.01 |
| IUPAC Name | dimethoxy(oxo)phosphanium;hydron |
| SMILES | CO[P+](=O)OC.[H+] |
| InChI | InChI=1S/C2H6O3P/c1-4-6(3)5-2/h1-2H3/q+1/p+1 |
| InChIKey | YLFBFPXKTIQSSY-UHFFFAOYSA-O |
| XLogP | 1.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.05 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(oxo)phosphanium;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(oxo)phosphanium;hydron?
The IUPAC name of dimethoxy(oxo)phosphanium;hydron (CID 174585571) is dimethoxy(oxo)phosphanium;hydron.
What is the SMILES notation for dimethoxy(oxo)phosphanium;hydron?
The canonical SMILES for dimethoxy(oxo)phosphanium;hydron is CO[P+](=O)OC.[H+].
What is the InChIKey of dimethoxy(oxo)phosphanium;hydron?
The InChIKey is YLFBFPXKTIQSSY-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H6O3P/c1-4-6(3)5-2/h1-2H3/q+1/p+1.
What are the key properties of dimethoxy(oxo)phosphanium;hydron?
dimethoxy(oxo)phosphanium;hydron has a molecular weight of 110.05 g/mol, XLogP of 1.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(oxo)phosphanium;hydron is sourced from PubChem (CID 174585571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).