About bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone
bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone (PubChem CID 174585752) has the molecular formula C15H8N6OS2
and a molecular weight of 352.40 g/mol. Its IUPAC name is bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone.
Molecular Properties
| Compound Name | bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone |
| PubChem CID | 174585752 |
| Molecular Formula | C15H8N6OS2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone |
| SMILES | O=C(c1nnc(-c2ccncc2)s1)c1nnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C15H8N6OS2/c22-11(14-20-18-12(23-14)9-1-5-16-6-2-9)15-21-19-13(24-15)10-3-7-17-8-4-10/h1-8H |
| InChIKey | KDTWFUQFNMOGMJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 94.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone?
The IUPAC name of bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone (CID 174585752) is bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone.
What is the SMILES notation for bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone?
The canonical SMILES for bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone is O=C(c1nnc(-c2ccncc2)s1)c1nnc(-c2ccncc2)s1.
What is the InChIKey of bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone?
The InChIKey is KDTWFUQFNMOGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N6OS2/c22-11(14-20-18-12(23-14)9-1-5-16-6-2-9)15-21-19-13(24-15)10-3-7-17-8-4-10/h1-8H.
What are the key properties of bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone?
bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone has a molecular weight of 352.40 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(5-pyridin-4-yl-1,3,4-thiadiazol-2-yl)methanone is sourced from PubChem (CID 174585752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).