About 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid)
2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) (PubChem CID 174585800) has the molecular formula C34H28FN3O6
and a molecular weight of 593.61 g/mol. Its IUPAC name is 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid).
Molecular Properties
| Compound Name | 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) |
| PubChem CID | 174585800 |
| Molecular Formula | C34H28FN3O6 |
| Molecular Weight | 593.61 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) |
| SMILES | COc1cc(F)ccc1CN1Cc2ccccc2C1=O.O=C(O)n1ccc2ccccc21.O=C(O)n1ccc2ccccc21 |
| InChI | InChI=1S/C16H14FNO2.2C9H7NO2/c1-20-15-8-13(17)7-6-12(15)10-18-9-11-4-2-3-5-14(11)16(18)19;2*11-9(12)10-6-5-7-3-1-2-4-8(7)10/h2-8H,9-10H2,1H3;2*1-6H,(H,11,12) |
| InChIKey | MKCFLXISCQEBRU-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 593.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid)?
The IUPAC name of 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) (CID 174585800) is 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid).
What is the SMILES notation for 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid)?
The canonical SMILES for 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) is COc1cc(F)ccc1CN1Cc2ccccc2C1=O.O=C(O)n1ccc2ccccc21.O=C(O)n1ccc2ccccc21.
What is the InChIKey of 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid)?
The InChIKey is MKCFLXISCQEBRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14FNO2.2C9H7NO2/c1-20-15-8-13(17)7-6-12(15)10-18-9-11-4-2-3-5-14(11)16(18)19;2*11-9(12)10-6-5-7-3-1-2-4-8(7)10/h2-8H,9-10H2,1H3;2*1-6H,(H,11,12).
What are the key properties of 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid)?
2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) has a molecular weight of 593.61 g/mol, XLogP of 7.33, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-fluoro-2-methoxyphenyl)methyl]-3H-isoindol-1-one;bis(indole-1-carboxylic acid) is sourced from PubChem (CID 174585800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).