About 1-ethyl-5-methylcyclopenta-1,3-diene;titanium
1-ethyl-5-methylcyclopenta-1,3-diene;titanium (PubChem CID 174586212) has the molecular formula C8H12Ti
and a molecular weight of 156.05 g/mol. Its IUPAC name is 1-ethyl-5-methylcyclopenta-1,3-diene;titanium.
Molecular Properties
| Compound Name | 1-ethyl-5-methylcyclopenta-1,3-diene;titanium |
| PubChem CID | 174586212 |
| Molecular Formula | C8H12Ti |
| Molecular Weight | 156.05 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | 1-ethyl-5-methylcyclopenta-1,3-diene;titanium |
| SMILES | CCC1=CC=CC1C.[Ti] |
| InChI | InChI=1S/C8H12.Ti/c1-3-8-6-4-5-7(8)2;/h4-7H,3H2,1-2H3; |
| InChIKey | HVKMQGPAAOZRTP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.05 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-5-methylcyclopenta-1,3-diene;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-methylcyclopenta-1,3-diene;titanium?
The IUPAC name of 1-ethyl-5-methylcyclopenta-1,3-diene;titanium (CID 174586212) is 1-ethyl-5-methylcyclopenta-1,3-diene;titanium.
What is the SMILES notation for 1-ethyl-5-methylcyclopenta-1,3-diene;titanium?
The canonical SMILES for 1-ethyl-5-methylcyclopenta-1,3-diene;titanium is CCC1=CC=CC1C.[Ti].
What is the InChIKey of 1-ethyl-5-methylcyclopenta-1,3-diene;titanium?
The InChIKey is HVKMQGPAAOZRTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.Ti/c1-3-8-6-4-5-7(8)2;/h4-7H,3H2,1-2H3;.
What are the key properties of 1-ethyl-5-methylcyclopenta-1,3-diene;titanium?
1-ethyl-5-methylcyclopenta-1,3-diene;titanium has a molecular weight of 156.05 g/mol, XLogP of 2.53, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-methylcyclopenta-1,3-diene;titanium is sourced from PubChem (CID 174586212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).