C18H25N7O — CID 174586544
(4-butanimidoylpiperidin-1-yl)-[4-(3,5-diamino-1,2,4-triazol-1-yl)phenyl]methanone (PubChem CID 174586544) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is (4-butanimidoylpiperidin-1-yl)-[4-(3,5-diamino-1,2,4-triazol-1-yl)phenyl]methanone.
| Compound Name | (4-butanimidoylpiperidin-1-yl)-[4-(3,5-diamino-1,2,4-triazol-1-yl)phenyl]methanone |
|---|---|
| PubChem CID | 174586544 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | (4-butanimidoylpiperidin-1-yl)-[4-(3,5-diamino-1,2,4-triazol-1-yl)phenyl]methanone |
| SMILES | [H]/N=C(\CCC)C1CCN(C(=O)c2ccc(-n3nc(N)nc3N)cc2)CC1 |
| InChI | InChI=1S/C18H25N7O/c1-2-3-15(19)12-8-10-24(11-9-12)16(26)13-4-6-14(7-5-13)25-18(21)22-17(20)23-25/h4-7,12,19H,2-3,8-11H2,1H3,(H4,20,21,22,23)/b19-15+ |
| InChIKey | PXFUYDQADIVLBP-XDJHFCHBSA-N |
| XLogP | 2.10 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|