About 3,3-dimethyl-2,4-dihydro-1H-chrysene
3,3-dimethyl-2,4-dihydro-1H-chrysene (PubChem CID 174587374) has the molecular formula C20H20
and a molecular weight of 260.38 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1H-chrysene.
Molecular Properties
| Compound Name | 3,3-dimethyl-2,4-dihydro-1H-chrysene |
| PubChem CID | 174587374 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1H-chrysene |
| SMILES | CC1(C)CCc2ccc3c(ccc4ccccc43)c2C1 |
| InChI | InChI=1S/C20H20/c1-20(2)12-11-15-8-9-17-16-6-4-3-5-14(16)7-10-18(17)19(15)13-20/h3-10H,11-13H2,1-2H3 |
| InChIKey | XIPLAPZSGBEOMH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-2,4-dihydro-1H-chrysene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2,4-dihydro-1H-chrysene?
The IUPAC name of 3,3-dimethyl-2,4-dihydro-1H-chrysene (CID 174587374) is 3,3-dimethyl-2,4-dihydro-1H-chrysene.
What is the SMILES notation for 3,3-dimethyl-2,4-dihydro-1H-chrysene?
The canonical SMILES for 3,3-dimethyl-2,4-dihydro-1H-chrysene is CC1(C)CCc2ccc3c(ccc4ccccc43)c2C1.
What is the InChIKey of 3,3-dimethyl-2,4-dihydro-1H-chrysene?
The InChIKey is XIPLAPZSGBEOMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20/c1-20(2)12-11-15-8-9-17-16-6-4-3-5-14(16)7-10-18(17)19(15)13-20/h3-10H,11-13H2,1-2H3.
What are the key properties of 3,3-dimethyl-2,4-dihydro-1H-chrysene?
3,3-dimethyl-2,4-dihydro-1H-chrysene has a molecular weight of 260.38 g/mol, XLogP of 5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2,4-dihydro-1H-chrysene is sourced from PubChem (CID 174587374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).