C23H18Br2Cl2O — CID 174587521
2,4-bis[1-(4-bromophenyl)cyclopropyl]-1,5-dichloropenta-1,4-dien-3-one (PubChem CID 174587521) has the molecular formula C23H18Br2Cl2O and a molecular weight of 541.11 g/mol. Its IUPAC name is 2,4-bis[1-(4-bromophenyl)cyclopropyl]-1,5-dichloropenta-1,4-dien-3-one.
| Compound Name | 2,4-bis[1-(4-bromophenyl)cyclopropyl]-1,5-dichloropenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 174587521 |
| Molecular Formula | C23H18Br2Cl2O |
| Molecular Weight | 541.11 g/mol |
| Exact Mass | 537.91 |
| IUPAC Name | 2,4-bis[1-(4-bromophenyl)cyclopropyl]-1,5-dichloropenta-1,4-dien-3-one |
| SMILES | O=C(C(=CCl)C1(c2ccc(Br)cc2)CC1)C(=CCl)C1(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C23H18Br2Cl2O/c24-17-5-1-15(2-6-17)22(9-10-22)19(13-26)21(28)20(14-27)23(11-12-23)16-3-7-18(25)8-4-16/h1-8,13-14H,9-12H2 |
| InChIKey | QMFKGPGLXYUQSD-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.11 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|