About (6-ethyl-3-pyridinyl) formate
(6-ethyl-3-pyridinyl) formate (PubChem CID 174587869) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is (6-ethyl-3-pyridinyl) formate.
Molecular Properties
| Compound Name | (6-ethyl-3-pyridinyl) formate |
| PubChem CID | 174587869 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (6-ethyl-3-pyridinyl) formate |
| SMILES | CCc1ccc(OC=O)cn1 |
| InChI | InChI=1S/C8H9NO2/c1-2-7-3-4-8(5-9-7)11-6-10/h3-6H,2H2,1H3 |
| InChIKey | CPVANTLTQGOXSG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (6-ethyl-3-pyridinyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-ethyl-3-pyridinyl) formate?
The IUPAC name of (6-ethyl-3-pyridinyl) formate (CID 174587869) is (6-ethyl-3-pyridinyl) formate.
What is the SMILES notation for (6-ethyl-3-pyridinyl) formate?
The canonical SMILES for (6-ethyl-3-pyridinyl) formate is CCc1ccc(OC=O)cn1.
What is the InChIKey of (6-ethyl-3-pyridinyl) formate?
The InChIKey is CPVANTLTQGOXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c1-2-7-3-4-8(5-9-7)11-6-10/h3-6H,2H2,1H3.
What are the key properties of (6-ethyl-3-pyridinyl) formate?
(6-ethyl-3-pyridinyl) formate has a molecular weight of 151.16 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-ethyl-3-pyridinyl) formate is sourced from PubChem (CID 174587869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).