About morpholin-2-yl 2-hydroxypropane-1-sulfonate
morpholin-2-yl 2-hydroxypropane-1-sulfonate (PubChem CID 174588483) has the molecular formula C7H15NO5S
and a molecular weight of 225.27 g/mol. Its IUPAC name is morpholin-2-yl 2-hydroxypropane-1-sulfonate.
Molecular Properties
| Compound Name | morpholin-2-yl 2-hydroxypropane-1-sulfonate |
| PubChem CID | 174588483 |
| Molecular Formula | C7H15NO5S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | morpholin-2-yl 2-hydroxypropane-1-sulfonate |
| SMILES | CC(O)CS(=O)(=O)OC1CNCCO1 |
| InChI | InChI=1S/C7H15NO5S/c1-6(9)5-14(10,11)13-7-4-8-2-3-12-7/h6-9H,2-5H2,1H3 |
| InChIKey | CFCSCPJGVNKBNC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze morpholin-2-yl 2-hydroxypropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholin-2-yl 2-hydroxypropane-1-sulfonate?
The IUPAC name of morpholin-2-yl 2-hydroxypropane-1-sulfonate (CID 174588483) is morpholin-2-yl 2-hydroxypropane-1-sulfonate.
What is the SMILES notation for morpholin-2-yl 2-hydroxypropane-1-sulfonate?
The canonical SMILES for morpholin-2-yl 2-hydroxypropane-1-sulfonate is CC(O)CS(=O)(=O)OC1CNCCO1.
What is the InChIKey of morpholin-2-yl 2-hydroxypropane-1-sulfonate?
The InChIKey is CFCSCPJGVNKBNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO5S/c1-6(9)5-14(10,11)13-7-4-8-2-3-12-7/h6-9H,2-5H2,1H3.
What are the key properties of morpholin-2-yl 2-hydroxypropane-1-sulfonate?
morpholin-2-yl 2-hydroxypropane-1-sulfonate has a molecular weight of 225.27 g/mol, XLogP of -1.34, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for morpholin-2-yl 2-hydroxypropane-1-sulfonate is sourced from PubChem (CID 174588483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).