C23H28ClN5O3S — CID 174588770
(E)-N-[1-(butylamino)prop-2-enylsulfonyl]-3-[5-(6-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide (PubChem CID 174588770) has the molecular formula C23H28ClN5O3S and a molecular weight of 490.03 g/mol. Its IUPAC name is (E)-N-[1-(butylamino)prop-2-enylsulfonyl]-3-[5-(6-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[1-(butylamino)prop-2-enylsulfonyl]-3-[5-(6-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174588770 |
| Molecular Formula | C23H28ClN5O3S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (E)-N-[1-(butylamino)prop-2-enylsulfonyl]-3-[5-(6-chloroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enamide |
| SMILES | C=CC(NCCCC)S(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1-n1ccc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H28ClN5O3S/c1-5-7-13-25-22(6-2)33(31,32)27-21(30)11-10-19-16(3)26-28(4)23(19)29-14-12-17-8-9-18(24)15-20(17)29/h6,8-12,14-15,22,25H,2,5,7,13H2,1,3-4H3,(H,27,30)/b11-10+ |
| InChIKey | NVTMRRUHZADAPG-ZHACJKMWSA-N |
| XLogP | 3.69 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|