About 7,7-dimethyl-6,8-dihydro-4H-quinazoline
7,7-dimethyl-6,8-dihydro-4H-quinazoline (PubChem CID 174588890) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 7,7-dimethyl-6,8-dihydro-4H-quinazoline.
Molecular Properties
| Compound Name | 7,7-dimethyl-6,8-dihydro-4H-quinazoline |
| PubChem CID | 174588890 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 7,7-dimethyl-6,8-dihydro-4H-quinazoline |
| SMILES | CC1(C)CC=C2CN=CN=C2C1 |
| InChI | InChI=1S/C10H14N2/c1-10(2)4-3-8-6-11-7-12-9(8)5-10/h3,7H,4-6H2,1-2H3 |
| InChIKey | WAMXMHKQBDKDAL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,7-dimethyl-6,8-dihydro-4H-quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-6,8-dihydro-4H-quinazoline?
The IUPAC name of 7,7-dimethyl-6,8-dihydro-4H-quinazoline (CID 174588890) is 7,7-dimethyl-6,8-dihydro-4H-quinazoline.
What is the SMILES notation for 7,7-dimethyl-6,8-dihydro-4H-quinazoline?
The canonical SMILES for 7,7-dimethyl-6,8-dihydro-4H-quinazoline is CC1(C)CC=C2CN=CN=C2C1.
What is the InChIKey of 7,7-dimethyl-6,8-dihydro-4H-quinazoline?
The InChIKey is WAMXMHKQBDKDAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-10(2)4-3-8-6-11-7-12-9(8)5-10/h3,7H,4-6H2,1-2H3.
What are the key properties of 7,7-dimethyl-6,8-dihydro-4H-quinazoline?
7,7-dimethyl-6,8-dihydro-4H-quinazoline has a molecular weight of 162.24 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-6,8-dihydro-4H-quinazoline is sourced from PubChem (CID 174588890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).