C12H22O2 — CID 174589091
(1S,6R)-3-methyl-3-pentoxy-7-oxabicyclo[4.1.0]heptane (PubChem CID 174589091) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1S,6R)-3-methyl-3-pentoxy-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (1S,6R)-3-methyl-3-pentoxy-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 174589091 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1S,6R)-3-methyl-3-pentoxy-7-oxabicyclo[4.1.0]heptane |
| SMILES | CCCCCOC1(C)CC[C@H]2O[C@H]2C1 |
| InChI | InChI=1S/C12H22O2/c1-3-4-5-8-13-12(2)7-6-10-11(9-12)14-10/h10-11H,3-9H2,1-2H3/t10-,11+,12?/m1/s1 |
| InChIKey | PPRBGEYIPHXSMM-UBNQGINQSA-N |
| XLogP | 2.90 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|