About 2-iminobut-3-en-1-amine
2-iminobut-3-en-1-amine (PubChem CID 174589213) has the molecular formula C4H8N2
and a molecular weight of 84.12 g/mol. Its IUPAC name is 2-iminobut-3-en-1-amine.
Molecular Properties
| Compound Name | 2-iminobut-3-en-1-amine |
| PubChem CID | 174589213 |
| Molecular Formula | C4H8N2 |
| Molecular Weight | 84.12 g/mol |
| Exact Mass | 84.07 |
| IUPAC Name | 2-iminobut-3-en-1-amine |
| SMILES | [H]/N=C(\C=C)CN |
| InChI | InChI=1S/C4H8N2/c1-2-4(6)3-5/h2,6H,1,3,5H2/b6-4+ |
| InChIKey | UABFWRCEKRYXGO-GQCTYLIASA-N |
| XLogP | 0.15 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.12 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-iminobut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iminobut-3-en-1-amine?
The IUPAC name of 2-iminobut-3-en-1-amine (CID 174589213) is 2-iminobut-3-en-1-amine.
What is the SMILES notation for 2-iminobut-3-en-1-amine?
The canonical SMILES for 2-iminobut-3-en-1-amine is [H]/N=C(\C=C)CN.
What is the InChIKey of 2-iminobut-3-en-1-amine?
The InChIKey is UABFWRCEKRYXGO-GQCTYLIASA-N. The full InChI is InChI=1S/C4H8N2/c1-2-4(6)3-5/h2,6H,1,3,5H2/b6-4+.
What are the key properties of 2-iminobut-3-en-1-amine?
2-iminobut-3-en-1-amine has a molecular weight of 84.12 g/mol, XLogP of 0.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iminobut-3-en-1-amine is sourced from PubChem (CID 174589213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).