About 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate
4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate (PubChem CID 174589250) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate.
Molecular Properties
| Compound Name | 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate |
| PubChem CID | 174589250 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate |
| SMILES | CN1C=CC(=CC=C2C=CC(C=O)C=C2)C=C1.O |
| InChI | InChI=1S/C15H15NO.H2O/c1-16-10-8-14(9-11-16)3-2-13-4-6-15(12-17)7-5-13;/h2-12,15H,1H3;1H2/b13-2-; |
| InChIKey | GYXQFFRBHRHTQZ-VDAXWUGKSA-N |
| XLogP | 1.93 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate?
The IUPAC name of 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate (CID 174589250) is 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate.
What is the SMILES notation for 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate?
The canonical SMILES for 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate is CN1C=CC(=CC=C2C=CC(C=O)C=C2)C=C1.O.
What is the InChIKey of 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate?
The InChIKey is GYXQFFRBHRHTQZ-VDAXWUGKSA-N. The full InChI is InChI=1S/C15H15NO.H2O/c1-16-10-8-14(9-11-16)3-2-13-4-6-15(12-17)7-5-13;/h2-12,15H,1H3;1H2/b13-2-;.
What are the key properties of 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate?
4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate has a molecular weight of 243.31 g/mol, XLogP of 1.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1-methyl-4-pyridinylidene)ethylidene]cyclohexa-2,5-diene-1-carbaldehyde;hydrate is sourced from PubChem (CID 174589250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).