C7H6F2N2O2 — CID 174589451
N-[6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]formamide (PubChem CID 174589451) has the molecular formula C7H6F2N2O2 and a molecular weight of 188.13 g/mol. Its IUPAC name is N-[6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]formamide.
| Compound Name | N-[6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]formamide |
|---|---|
| PubChem CID | 174589451 |
| Molecular Formula | C7H6F2N2O2 |
| Molecular Weight | 188.13 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-[6-(difluoromethyl)-2-oxo-1H-pyridin-3-yl]formamide |
| SMILES | O=CNc1ccc(C(F)F)[nH]c1=O |
| InChI | InChI=1S/C7H6F2N2O2/c8-6(9)4-1-2-5(10-3-12)7(13)11-4/h1-3,6H,(H,10,12)(H,11,13) |
| InChIKey | NZUXWUCFNXGNCK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.13 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|