About hexadecan-7-ol;octadecanoic acid
hexadecan-7-ol;octadecanoic acid (PubChem CID 174589795) has the molecular formula C34H70O3
and a molecular weight of 526.93 g/mol. Its IUPAC name is hexadecan-7-ol;octadecanoic acid.
Molecular Properties
| Compound Name | hexadecan-7-ol;octadecanoic acid |
| PubChem CID | 174589795 |
| Molecular Formula | C34H70O3 |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.53 |
| IUPAC Name | hexadecan-7-ol;octadecanoic acid |
| SMILES | CCCCCCCCCC(O)CCCCCC.CCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H36O2.C16H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2/h2-17H2,1H3,(H,19,20);16-17H,3-15H2,1-2H3 |
| InChIKey | ITBPLHISCCEWJG-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexadecan-7-ol;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecan-7-ol;octadecanoic acid?
The IUPAC name of hexadecan-7-ol;octadecanoic acid (CID 174589795) is hexadecan-7-ol;octadecanoic acid.
What is the SMILES notation for hexadecan-7-ol;octadecanoic acid?
The canonical SMILES for hexadecan-7-ol;octadecanoic acid is CCCCCCCCCC(O)CCCCCC.CCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of hexadecan-7-ol;octadecanoic acid?
The InChIKey is ITBPLHISCCEWJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C16H34O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2/h2-17H2,1H3,(H,19,20);16-17H,3-15H2,1-2H3.
What are the key properties of hexadecan-7-ol;octadecanoic acid?
hexadecan-7-ol;octadecanoic acid has a molecular weight of 526.93 g/mol, XLogP of 11.79, 29 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecan-7-ol;octadecanoic acid is sourced from PubChem (CID 174589795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).