C14H30O3Si — CID 174589925
1,1,2-trimethoxy-2,3-dipropylsilinane (PubChem CID 174589925) has the molecular formula C14H30O3Si and a molecular weight of 274.48 g/mol. Its IUPAC name is 1,1,2-trimethoxy-2,3-dipropylsilinane.
| Compound Name | 1,1,2-trimethoxy-2,3-dipropylsilinane |
|---|---|
| PubChem CID | 174589925 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1,1,2-trimethoxy-2,3-dipropylsilinane |
| SMILES | CCCC1CCC[Si](OC)(OC)C1(CCC)OC |
| InChI | InChI=1S/C14H30O3Si/c1-6-9-13-10-8-12-18(16-4,17-5)14(13,15-3)11-7-2/h13H,6-12H2,1-5H3 |
| InChIKey | AEEGYKPQNPQOLR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|