About 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione
7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione (PubChem CID 174590266) has the molecular formula C14H8Cl2N2OS3
and a molecular weight of 387.34 g/mol. Its IUPAC name is 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione |
| PubChem CID | 174590266 |
| Molecular Formula | C14H8Cl2N2OS3 |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 385.92 |
| IUPAC Name | 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione |
| SMILES | S=c1[nH]c2cccc(Cl)c2o1.S=c1[nH]c2cccc(Cl)c2s1 |
| InChI | InChI=1S/C7H4ClNOS.C7H4ClNS2/c8-4-2-1-3-5-6(4)10-7(11)9-5;8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,(H,9,11);1-3H,(H,9,10) |
| InChIKey | ROYRFVABSAWGMR-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 44.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione?
The IUPAC name of 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione (CID 174590266) is 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione.
What is the SMILES notation for 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione?
The canonical SMILES for 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione is S=c1[nH]c2cccc(Cl)c2o1.S=c1[nH]c2cccc(Cl)c2s1.
What is the InChIKey of 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione?
The InChIKey is ROYRFVABSAWGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4ClNOS.C7H4ClNS2/c8-4-2-1-3-5-6(4)10-7(11)9-5;8-4-2-1-3-5-6(4)11-7(10)9-5/h1-3H,(H,9,11);1-3H,(H,9,10).
What are the key properties of 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione?
7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione has a molecular weight of 387.34 g/mol, XLogP of 6.76, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-3H-1,3-benzothiazole-2-thione;7-chloro-3H-1,3-benzoxazole-2-thione is sourced from PubChem (CID 174590266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).