C20H35N3O3 — CID 17459032
N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]cyclohexanecarboxamide (PubChem CID 17459032) has the molecular formula C20H35N3O3 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 17459032 |
| Molecular Formula | C20H35N3O3 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.27 |
| IUPAC Name | N-[2-[(1-morpholin-4-ylcyclohexyl)methylamino]-2-oxoethyl]cyclohexanecarboxamide |
| SMILES | O=C(CNC(=O)C1CCCCC1)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C20H35N3O3/c24-18(15-21-19(25)17-7-3-1-4-8-17)22-16-20(9-5-2-6-10-20)23-11-13-26-14-12-23/h17H,1-16H2,(H,21,25)(H,22,24) |
| InChIKey | ZDFQCUXESZWARG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |