C19H18ClN7OS2 — CID 174590374
9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine;4-chloro-1,3-benzothiazole (PubChem CID 174590374) has the molecular formula C19H18ClN7OS2 and a molecular weight of 459.99 g/mol. Its IUPAC name is 9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine;4-chloro-1,3-benzothiazole.
| Compound Name | 9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine;4-chloro-1,3-benzothiazole |
|---|---|
| PubChem CID | 174590374 |
| Molecular Formula | C19H18ClN7OS2 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 9-butyl-8-(1,3-oxazol-2-ylsulfanyl)purin-6-amine;4-chloro-1,3-benzothiazole |
| SMILES | CCCCn1c(Sc2ncco2)nc2c(N)ncnc21.Clc1cccc2scnc12 |
| InChI | InChI=1S/C12H14N6OS.C7H4ClNS/c1-2-3-5-18-10-8(9(13)15-7-16-10)17-11(18)20-12-14-4-6-19-12;8-5-2-1-3-6-7(5)9-4-10-6/h4,6-7H,2-3,5H2,1H3,(H2,13,15,16);1-4H |
| InChIKey | MKTZOFXPSYOEDD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |