C22H16N6O3 — CID 174590872
9-(3-methoxyphenyl)-8-oxo-2-quinolin-5-yl-7H-purine-6-carboxamide (PubChem CID 174590872) has the molecular formula C22H16N6O3 and a molecular weight of 412.41 g/mol. Its IUPAC name is 9-(3-methoxyphenyl)-8-oxo-2-quinolin-5-yl-7H-purine-6-carboxamide.
| Compound Name | 9-(3-methoxyphenyl)-8-oxo-2-quinolin-5-yl-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 174590872 |
| Molecular Formula | C22H16N6O3 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 9-(3-methoxyphenyl)-8-oxo-2-quinolin-5-yl-7H-purine-6-carboxamide |
| SMILES | COc1cccc(-n2c(=O)[nH]c3c(C(N)=O)nc(-c4cccc5ncccc45)nc32)c1 |
| InChI | InChI=1S/C22H16N6O3/c1-31-13-6-2-5-12(11-13)28-21-18(26-22(28)30)17(19(23)29)25-20(27-21)15-7-3-9-16-14(15)8-4-10-24-16/h2-11H,1H3,(H2,23,29)(H,26,30) |
| InChIKey | MNVVADOUBZVKMT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |