About [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate
[(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174591422) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate |
| PubChem CID | 174591422 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1nc(N2CCN(OC(=O)C(C)(C)C)[C@H](C)C2)ccc1N |
| InChI | InChI=1S/C16H26N4O2/c1-11-10-19(14-7-6-13(17)12(2)18-14)8-9-20(11)22-15(21)16(3,4)5/h6-7,11H,8-10,17H2,1-5H3/t11-/m1/s1 |
| InChIKey | JQCXGEZRXXJACJ-LLVKDONJSA-N |
| XLogP | 1.99 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate (CID 174591422) is [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate is Cc1nc(N2CCN(OC(=O)C(C)(C)C)[C@H](C)C2)ccc1N.
What is the InChIKey of [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate?
The InChIKey is JQCXGEZRXXJACJ-LLVKDONJSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-11-10-19(14-7-6-13(17)12(2)18-14)8-9-20(11)22-15(21)16(3,4)5/h6-7,11H,8-10,17H2,1-5H3/t11-/m1/s1.
What are the key properties of [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate?
[(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate has a molecular weight of 306.41 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-(5-amino-6-methyl-2-pyridinyl)-2-methylpiperazin-1-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174591422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).