C12H20W — CID 174591555
ethane;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;tungsten(2+) (PubChem CID 174591555) has the molecular formula C12H20W and a molecular weight of 348.13 g/mol. Its IUPAC name is ethane;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;tungsten(2+).
| Compound Name | ethane;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;tungsten(2+) |
|---|---|
| PubChem CID | 174591555 |
| Molecular Formula | C12H20W |
| Molecular Weight | 348.13 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | ethane;1,2,3,5,5-pentamethylcyclopenta-1,3-diene;tungsten(2+) |
| SMILES | CC1=[C-]C(C)(C)C(C)=C1C.[CH2-]C.[W+2] |
| InChI | InChI=1S/C10H15.C2H5.W/c1-7-6-10(4,5)9(3)8(7)2;1-2;/h1-5H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | KGQFPMWJSZNHTN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.13 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|