About (Z)-but-2-enedioic acid;toluene;hydrochloride
(Z)-but-2-enedioic acid;toluene;hydrochloride (PubChem CID 174592168) has the molecular formula C11H13ClO4
and a molecular weight of 244.67 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;toluene;hydrochloride.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;toluene;hydrochloride |
| PubChem CID | 174592168 |
| Molecular Formula | C11H13ClO4 |
| Molecular Weight | 244.67 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (Z)-but-2-enedioic acid;toluene;hydrochloride |
| SMILES | Cc1ccccc1.Cl.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C7H8.C4H4O4.ClH/c1-7-5-3-2-4-6-7;5-3(6)1-2-4(7)8;/h2-6H,1H3;1-2H,(H,5,6)(H,7,8);1H/b;2-1-; |
| InChIKey | VCWUZYQRZGBLJA-FJOGWHKWSA-N |
| XLogP | 2.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.67 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;toluene;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;toluene;hydrochloride?
The IUPAC name of (Z)-but-2-enedioic acid;toluene;hydrochloride (CID 174592168) is (Z)-but-2-enedioic acid;toluene;hydrochloride.
What is the SMILES notation for (Z)-but-2-enedioic acid;toluene;hydrochloride?
The canonical SMILES for (Z)-but-2-enedioic acid;toluene;hydrochloride is Cc1ccccc1.Cl.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;toluene;hydrochloride?
The InChIKey is VCWUZYQRZGBLJA-FJOGWHKWSA-N. The full InChI is InChI=1S/C7H8.C4H4O4.ClH/c1-7-5-3-2-4-6-7;5-3(6)1-2-4(7)8;/h2-6H,1H3;1-2H,(H,5,6)(H,7,8);1H/b;2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;toluene;hydrochloride?
(Z)-but-2-enedioic acid;toluene;hydrochloride has a molecular weight of 244.67 g/mol, XLogP of 2.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;toluene;hydrochloride is sourced from PubChem (CID 174592168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).