About 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine
2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (PubChem CID 174593497) has the molecular formula C10H12N2O2S
and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
| PubChem CID | 174593497 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
| SMILES | C=CCS(=O)(=O)c1ccc2c(n1)CNC2 |
| InChI | InChI=1S/C10H12N2O2S/c1-2-5-15(13,14)10-4-3-8-6-11-7-9(8)12-10/h2-4,11H,1,5-7H2 |
| InChIKey | PJXCUSWJHCUQKY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The IUPAC name of 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine (CID 174593497) is 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine.
What is the SMILES notation for 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The canonical SMILES for 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is C=CCS(=O)(=O)c1ccc2c(n1)CNC2.
What is the InChIKey of 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
The InChIKey is PJXCUSWJHCUQKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-2-5-15(13,14)10-4-3-8-6-11-7-9(8)12-10/h2-4,11H,1,5-7H2.
What are the key properties of 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine?
2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine has a molecular weight of 224.28 g/mol, XLogP of 0.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylsulfonyl-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is sourced from PubChem (CID 174593497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).