C8H19NO2Si — CID 174594179
N-[1,1-dimethoxyethyl(ethenyl)silyl]-N-methylmethanamine (PubChem CID 174594179) has the molecular formula C8H19NO2Si and a molecular weight of 189.33 g/mol. Its IUPAC name is N-[1,1-dimethoxyethyl(ethenyl)silyl]-N-methylmethanamine.
| Compound Name | N-[1,1-dimethoxyethyl(ethenyl)silyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 174594179 |
| Molecular Formula | C8H19NO2Si |
| Molecular Weight | 189.33 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | N-[1,1-dimethoxyethyl(ethenyl)silyl]-N-methylmethanamine |
| SMILES | C=C[SiH](N(C)C)C(C)(OC)OC |
| InChI | InChI=1S/C8H19NO2Si/c1-7-12(9(3)4)8(2,10-5)11-6/h7,12H,1H2,2-6H3 |
| InChIKey | AAKZZWGEXARLHG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|