C12H19F3N2O4 — CID 174595246
3-methyl-2-[(2S)-pyrrolidine-2-carbonyl]butanamide;2,2,2-trifluoroacetic acid (PubChem CID 174595246) has the molecular formula C12H19F3N2O4 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-methyl-2-[(2S)-pyrrolidine-2-carbonyl]butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-methyl-2-[(2S)-pyrrolidine-2-carbonyl]butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 174595246 |
| Molecular Formula | C12H19F3N2O4 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 3-methyl-2-[(2S)-pyrrolidine-2-carbonyl]butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)C(C(N)=O)C(=O)[C@@H]1CCCN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C10H18N2O2.C2HF3O2/c1-6(2)8(10(11)14)9(13)7-4-3-5-12-7;3-2(4,5)1(6)7/h6-8,12H,3-5H2,1-2H3,(H2,11,14);(H,6,7)/t7-,8?;/m0./s1 |
| InChIKey | REXLYHQECMWWMA-JPPWUZRISA-N |
| XLogP | 0.70 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|