About formaldehyde;phenol;2-sulfoacetic acid
formaldehyde;phenol;2-sulfoacetic acid (PubChem CID 174595329) has the molecular formula C9H12O7S
and a molecular weight of 264.25 g/mol. Its IUPAC name is formaldehyde;phenol;2-sulfoacetic acid.
Molecular Properties
| Compound Name | formaldehyde;phenol;2-sulfoacetic acid |
| PubChem CID | 174595329 |
| Molecular Formula | C9H12O7S |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | formaldehyde;phenol;2-sulfoacetic acid |
| SMILES | C=O.O=C(O)CS(=O)(=O)O.Oc1ccccc1 |
| InChI | InChI=1S/C6H6O.C2H4O5S.CH2O/c7-6-4-2-1-3-5-6;3-2(4)1-8(5,6)7;1-2/h1-5,7H;1H2,(H,3,4)(H,5,6,7);1H2 |
| InChIKey | HLYYMXPEPKJTNZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;phenol;2-sulfoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;phenol;2-sulfoacetic acid?
The IUPAC name of formaldehyde;phenol;2-sulfoacetic acid (CID 174595329) is formaldehyde;phenol;2-sulfoacetic acid.
What is the SMILES notation for formaldehyde;phenol;2-sulfoacetic acid?
The canonical SMILES for formaldehyde;phenol;2-sulfoacetic acid is C=O.O=C(O)CS(=O)(=O)O.Oc1ccccc1.
What is the InChIKey of formaldehyde;phenol;2-sulfoacetic acid?
The InChIKey is HLYYMXPEPKJTNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O.C2H4O5S.CH2O/c7-6-4-2-1-3-5-6;3-2(4)1-8(5,6)7;1-2/h1-5,7H;1H2,(H,3,4)(H,5,6,7);1H2.
What are the key properties of formaldehyde;phenol;2-sulfoacetic acid?
formaldehyde;phenol;2-sulfoacetic acid has a molecular weight of 264.25 g/mol, XLogP of 0.17, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;phenol;2-sulfoacetic acid is sourced from PubChem (CID 174595329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).