About 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine
4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine (PubChem CID 174595744) has the molecular formula C20H24N4
and a molecular weight of 320.44 g/mol. Its IUPAC name is 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine.
Molecular Properties
| Compound Name | 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine |
| PubChem CID | 174595744 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)Cc1nc(-c2ccnc(NC(C)C)c2)cc2cnccc12 |
| InChI | InChI=1S/C20H24N4/c1-13(2)9-19-17-6-7-21-12-16(17)10-18(24-19)15-5-8-22-20(11-15)23-14(3)4/h5-8,10-14H,9H2,1-4H3,(H,22,23) |
| InChIKey | XVZTYSCFTRCYFT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine?
The IUPAC name of 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine (CID 174595744) is 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine.
What is the SMILES notation for 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine?
The canonical SMILES for 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine is CC(C)Cc1nc(-c2ccnc(NC(C)C)c2)cc2cnccc12.
What is the InChIKey of 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine?
The InChIKey is XVZTYSCFTRCYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4/c1-13(2)9-19-17-6-7-21-12-16(17)10-18(24-19)15-5-8-22-20(11-15)23-14(3)4/h5-8,10-14H,9H2,1-4H3,(H,22,23).
What are the key properties of 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine?
4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine has a molecular weight of 320.44 g/mol, XLogP of 4.71, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2-methylpropyl)-2,6-naphthyridin-3-yl]-N-propan-2-ylpyridin-2-amine is sourced from PubChem (CID 174595744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).