About 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium
2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium (PubChem CID 174595951) has the molecular formula C10H15Zr-
and a molecular weight of 226.45 g/mol. Its IUPAC name is 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium.
Molecular Properties
| Compound Name | 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium |
| PubChem CID | 174595951 |
| Molecular Formula | C10H15Zr- |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium |
| SMILES | CC(C)CCC1=CC[C-]=C1.[Zr] |
| InChI | InChI=1S/C10H15.Zr/c1-9(2)7-8-10-5-3-4-6-10;/h5-6,9H,3,7-8H2,1-2H3;/q-1; |
| InChIKey | VFBDWMWAQXJZBN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium?
The IUPAC name of 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium (CID 174595951) is 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium.
What is the SMILES notation for 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium?
The canonical SMILES for 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium is CC(C)CCC1=CC[C-]=C1.[Zr].
What is the InChIKey of 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium?
The InChIKey is VFBDWMWAQXJZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15.Zr/c1-9(2)7-8-10-5-3-4-6-10;/h5-6,9H,3,7-8H2,1-2H3;/q-1;.
What are the key properties of 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium?
2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium has a molecular weight of 226.45 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylbutyl)cyclopenta-1,3-diene;zirconium is sourced from PubChem (CID 174595951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).