About 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol
2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol (PubChem CID 174596481) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol.
Molecular Properties
| Compound Name | 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol |
| PubChem CID | 174596481 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol |
| SMILES | C=C(c1ccsn1)C(O)O |
| InChI | InChI=1S/C6H7NO2S/c1-4(6(8)9)5-2-3-10-7-5/h2-3,6,8-9H,1H2 |
| InChIKey | KHHHPIQMXYBHMB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol?
The IUPAC name of 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol (CID 174596481) is 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol.
What is the SMILES notation for 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol?
The canonical SMILES for 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol is C=C(c1ccsn1)C(O)O.
What is the InChIKey of 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol?
The InChIKey is KHHHPIQMXYBHMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-4(6(8)9)5-2-3-10-7-5/h2-3,6,8-9H,1H2.
What are the key properties of 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol?
2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol has a molecular weight of 157.19 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-thiazol-3-yl)prop-2-ene-1,1-diol is sourced from PubChem (CID 174596481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).