About butyl hexadecanoate;oxirane
butyl hexadecanoate;oxirane (PubChem CID 174596591) has the molecular formula C22H44O3
and a molecular weight of 356.59 g/mol. Its IUPAC name is butyl hexadecanoate;oxirane.
Molecular Properties
| Compound Name | butyl hexadecanoate;oxirane |
| PubChem CID | 174596591 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | butyl hexadecanoate;oxirane |
| SMILES | C1CO1.CCCCCCCCCCCCCCCC(=O)OCCCC |
| InChI | InChI=1S/C20H40O2.C2H4O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20(21)22-19-6-4-2;1-2-3-1/h3-19H2,1-2H3;1-2H2 |
| InChIKey | ISZYGXMTYYFWCL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butyl hexadecanoate;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl hexadecanoate;oxirane?
The IUPAC name of butyl hexadecanoate;oxirane (CID 174596591) is butyl hexadecanoate;oxirane.
What is the SMILES notation for butyl hexadecanoate;oxirane?
The canonical SMILES for butyl hexadecanoate;oxirane is C1CO1.CCCCCCCCCCCCCCCC(=O)OCCCC.
What is the InChIKey of butyl hexadecanoate;oxirane?
The InChIKey is ISZYGXMTYYFWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40O2.C2H4O/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-20(21)22-19-6-4-2;1-2-3-1/h3-19H2,1-2H3;1-2H2.
What are the key properties of butyl hexadecanoate;oxirane?
butyl hexadecanoate;oxirane has a molecular weight of 356.59 g/mol, XLogP of 6.83, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl hexadecanoate;oxirane is sourced from PubChem (CID 174596591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).