C16H21F6NO2 — CID 174597211
2-amino-2-methyl-4-[4-(4,4,4-trifluorobutoxy)-3-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 174597211) has the molecular formula C16H21F6NO2 and a molecular weight of 373.34 g/mol. Its IUPAC name is 2-amino-2-methyl-4-[4-(4,4,4-trifluorobutoxy)-3-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-amino-2-methyl-4-[4-(4,4,4-trifluorobutoxy)-3-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 174597211 |
| Molecular Formula | C16H21F6NO2 |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-amino-2-methyl-4-[4-(4,4,4-trifluorobutoxy)-3-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CC(N)(CO)CCc1ccc(OCCCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F6NO2/c1-14(23,10-24)7-5-11-3-4-13(12(9-11)16(20,21)22)25-8-2-6-15(17,18)19/h3-4,9,24H,2,5-8,10,23H2,1H3 |
| InChIKey | VXDRTCLXQFLTBN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|