About 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride
1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride (PubChem CID 174597253) has the molecular formula C11H15ClN2O4
and a molecular weight of 274.70 g/mol. Its IUPAC name is 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride |
| PubChem CID | 174597253 |
| Molecular Formula | C11H15ClN2O4 |
| Molecular Weight | 274.70 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride |
| SMILES | C=CCOC(=O)C(C(=O)OCC)n1ccnc1.Cl |
| InChI | InChI=1S/C11H14N2O4.ClH/c1-3-7-17-11(15)9(10(14)16-4-2)13-6-5-12-8-13;/h3,5-6,8-9H,1,4,7H2,2H3;1H |
| InChIKey | MWCKDZOFQIXNOQ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.70 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride?
The IUPAC name of 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride (CID 174597253) is 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride.
What is the SMILES notation for 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride?
The canonical SMILES for 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride is C=CCOC(=O)C(C(=O)OCC)n1ccnc1.Cl.
What is the InChIKey of 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride?
The InChIKey is MWCKDZOFQIXNOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O4.ClH/c1-3-7-17-11(15)9(10(14)16-4-2)13-6-5-12-8-13;/h3,5-6,8-9H,1,4,7H2,2H3;1H.
What are the key properties of 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride?
1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride has a molecular weight of 274.70 g/mol, XLogP of 1.14, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-prop-2-enyl 2-imidazol-1-ylpropanedioate;hydrochloride is sourced from PubChem (CID 174597253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).