About 9H-fluorene;methyl(triphenyl)phosphanium;iodide
9H-fluorene;methyl(triphenyl)phosphanium;iodide (PubChem CID 174597784) has the molecular formula C32H28IP
and a molecular weight of 570.45 g/mol. Its IUPAC name is 9H-fluorene;methyl(triphenyl)phosphanium;iodide.
Molecular Properties
| Compound Name | 9H-fluorene;methyl(triphenyl)phosphanium;iodide |
| PubChem CID | 174597784 |
| Molecular Formula | C32H28IP |
| Molecular Weight | 570.45 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | 9H-fluorene;methyl(triphenyl)phosphanium;iodide |
| SMILES | C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-].c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C19H18P.C13H10.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h2-16H,1H3;1-8H,9H2;1H/q+1;;/p-1 |
| InChIKey | YGXGBDAXRGDZTB-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 570.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluorene;methyl(triphenyl)phosphanium;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluorene;methyl(triphenyl)phosphanium;iodide?
The IUPAC name of 9H-fluorene;methyl(triphenyl)phosphanium;iodide (CID 174597784) is 9H-fluorene;methyl(triphenyl)phosphanium;iodide.
What is the SMILES notation for 9H-fluorene;methyl(triphenyl)phosphanium;iodide?
The canonical SMILES for 9H-fluorene;methyl(triphenyl)phosphanium;iodide is C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[I-].c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of 9H-fluorene;methyl(triphenyl)phosphanium;iodide?
The InChIKey is YGXGBDAXRGDZTB-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H18P.C13H10.HI/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h2-16H,1H3;1-8H,9H2;1H/q+1;;/p-1.
What are the key properties of 9H-fluorene;methyl(triphenyl)phosphanium;iodide?
9H-fluorene;methyl(triphenyl)phosphanium;iodide has a molecular weight of 570.45 g/mol, XLogP of 3.87, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluorene;methyl(triphenyl)phosphanium;iodide is sourced from PubChem (CID 174597784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).