C8H14Cl2N2S2 — CID 174598456
2,5-diamino-3,6-dimethylbenzene-1,4-dithiol;dihydrochloride (PubChem CID 174598456) has the molecular formula C8H14Cl2N2S2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2,5-diamino-3,6-dimethylbenzene-1,4-dithiol;dihydrochloride.
| Compound Name | 2,5-diamino-3,6-dimethylbenzene-1,4-dithiol;dihydrochloride |
|---|---|
| PubChem CID | 174598456 |
| Molecular Formula | C8H14Cl2N2S2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 2,5-diamino-3,6-dimethylbenzene-1,4-dithiol;dihydrochloride |
| SMILES | Cc1c(N)c(S)c(C)c(N)c1S.Cl.Cl |
| InChI | InChI=1S/C8H12N2S2.2ClH/c1-3-5(9)8(12)4(2)6(10)7(3)11;;/h11-12H,9-10H2,1-2H3;2*1H |
| InChIKey | OCOMJELSDYJHLD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|