C7H11N3O6 — CID 174598770
1-(3-hydroxy-2-methoxypropoxy)-1,3,5-triazinane-2,4,6-trione (PubChem CID 174598770) has the molecular formula C7H11N3O6 and a molecular weight of 233.18 g/mol. Its IUPAC name is 1-(3-hydroxy-2-methoxypropoxy)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(3-hydroxy-2-methoxypropoxy)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 174598770 |
| Molecular Formula | C7H11N3O6 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 1-(3-hydroxy-2-methoxypropoxy)-1,3,5-triazinane-2,4,6-trione |
| SMILES | COC(CO)COn1c(=O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H11N3O6/c1-15-4(2-11)3-16-10-6(13)8-5(12)9-7(10)14/h4,11H,2-3H2,1H3,(H2,8,9,12,13,14) |
| InChIKey | CGGHVFDZOXWDQY-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |