C17H25ClN2O2 — CID 174598916
[4-[(3-chloroanilino)methyl]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174598916) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is [4-[(3-chloroanilino)methyl]piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(3-chloroanilino)methyl]piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174598916 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [4-[(3-chloroanilino)methyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(CNc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClN2O2/c1-17(2,3)16(21)22-20-9-7-13(8-10-20)12-19-15-6-4-5-14(18)11-15/h4-6,11,13,19H,7-10,12H2,1-3H3 |
| InChIKey | XORYEPOADHJXQC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |