About 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole
2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole (PubChem CID 174599108) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole.
Molecular Properties
| Compound Name | 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole |
| PubChem CID | 174599108 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole |
| SMILES | CC1C=C2C=C(C3CCCCC3)N=C2CC1 |
| InChI | InChI=1S/C15H21N/c1-11-7-8-14-13(9-11)10-15(16-14)12-5-3-2-4-6-12/h9-12H,2-8H2,1H3 |
| InChIKey | NEWHNIZENGASTM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole?
The IUPAC name of 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole (CID 174599108) is 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole.
What is the SMILES notation for 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole?
The canonical SMILES for 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole is CC1C=C2C=C(C3CCCCC3)N=C2CC1.
What is the InChIKey of 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole?
The InChIKey is NEWHNIZENGASTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N/c1-11-7-8-14-13(9-11)10-15(16-14)12-5-3-2-4-6-12/h9-12H,2-8H2,1H3.
What are the key properties of 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole?
2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole has a molecular weight of 215.34 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-5-methyl-6,7-dihydro-5H-indole is sourced from PubChem (CID 174599108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).