C15H19F3O2S — CID 174599715
3-ethynyl-6-(4,4,4-trifluoro-1-prop-2-enylsulfonylbutyl)cyclohexene (PubChem CID 174599715) has the molecular formula C15H19F3O2S and a molecular weight of 320.38 g/mol. Its IUPAC name is 3-ethynyl-6-(4,4,4-trifluoro-1-prop-2-enylsulfonylbutyl)cyclohexene.
| Compound Name | 3-ethynyl-6-(4,4,4-trifluoro-1-prop-2-enylsulfonylbutyl)cyclohexene |
|---|---|
| PubChem CID | 174599715 |
| Molecular Formula | C15H19F3O2S |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-ethynyl-6-(4,4,4-trifluoro-1-prop-2-enylsulfonylbutyl)cyclohexene |
| SMILES | C#CC1C=CC(C(CCC(F)(F)F)S(=O)(=O)CC=C)CC1 |
| InChI | InChI=1S/C15H19F3O2S/c1-3-11-21(19,20)14(9-10-15(16,17)18)13-7-5-12(4-2)6-8-13/h2-3,5,7,12-14H,1,6,8-11H2 |
| InChIKey | LBKUTQRTIXVSQQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|