About phenol;7H-purine-2-carbaldehyde
phenol;7H-purine-2-carbaldehyde (PubChem CID 174600376) has the molecular formula C12H10N4O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is phenol;7H-purine-2-carbaldehyde.
Molecular Properties
| Compound Name | phenol;7H-purine-2-carbaldehyde |
| PubChem CID | 174600376 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | phenol;7H-purine-2-carbaldehyde |
| SMILES | O=Cc1ncc2[nH]cnc2n1.Oc1ccccc1 |
| InChI | InChI=1S/C6H4N4O.C6H6O/c11-2-5-7-1-4-6(10-5)9-3-8-4;7-6-4-2-1-3-5-6/h1-3H,(H,7,8,9,10);1-5,7H |
| InChIKey | LCELRBQKBYTHIW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze phenol;7H-purine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;7H-purine-2-carbaldehyde?
The IUPAC name of phenol;7H-purine-2-carbaldehyde (CID 174600376) is phenol;7H-purine-2-carbaldehyde.
What is the SMILES notation for phenol;7H-purine-2-carbaldehyde?
The canonical SMILES for phenol;7H-purine-2-carbaldehyde is O=Cc1ncc2[nH]cnc2n1.Oc1ccccc1.
What is the InChIKey of phenol;7H-purine-2-carbaldehyde?
The InChIKey is LCELRBQKBYTHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O.C6H6O/c11-2-5-7-1-4-6(10-5)9-3-8-4;7-6-4-2-1-3-5-6/h1-3H,(H,7,8,9,10);1-5,7H.
What are the key properties of phenol;7H-purine-2-carbaldehyde?
phenol;7H-purine-2-carbaldehyde has a molecular weight of 242.24 g/mol, XLogP of 1.56, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;7H-purine-2-carbaldehyde is sourced from PubChem (CID 174600376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).