C16H26N8 — CID 174600584
1-[6-[6-(dimethylamino)-4-iminoheptyl]-3-pyridinyl]-1,2,4-triazole-3,5-diamine (PubChem CID 174600584) has the molecular formula C16H26N8 and a molecular weight of 330.44 g/mol. Its IUPAC name is 1-[6-[6-(dimethylamino)-4-iminoheptyl]-3-pyridinyl]-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-[6-[6-(dimethylamino)-4-iminoheptyl]-3-pyridinyl]-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 174600584 |
| Molecular Formula | C16H26N8 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 1-[6-[6-(dimethylamino)-4-iminoheptyl]-3-pyridinyl]-1,2,4-triazole-3,5-diamine |
| SMILES | [H]/N=C(/CCCc1ccc(-n2nc(N)nc2N)cn1)CC(C)N(C)C |
| InChI | InChI=1S/C16H26N8/c1-11(23(2)3)9-12(17)5-4-6-13-7-8-14(10-20-13)24-16(19)21-15(18)22-24/h7-8,10-11,17H,4-6,9H2,1-3H3,(H4,18,19,21,22)/b17-12- |
| InChIKey | CZKQDBDTPPDUCS-ATVHPVEESA-N |
| XLogP | 1.51 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|