C10H11O2P — CID 174600753
oxophosphane;2,3,4-trimethylbicyclo[4.1.0]hepta-1(6),2,4-trien-7-one (PubChem CID 174600753) has the molecular formula C10H11O2P and a molecular weight of 194.17 g/mol. Its IUPAC name is oxophosphane;2,3,4-trimethylbicyclo[4.1.0]hepta-1(6),2,4-trien-7-one.
| Compound Name | oxophosphane;2,3,4-trimethylbicyclo[4.1.0]hepta-1(6),2,4-trien-7-one |
|---|---|
| PubChem CID | 174600753 |
| Molecular Formula | C10H11O2P |
| Molecular Weight | 194.17 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | oxophosphane;2,3,4-trimethylbicyclo[4.1.0]hepta-1(6),2,4-trien-7-one |
| SMILES | Cc1cc2c(=O)c2c(C)c1C.O=P |
| InChI | InChI=1S/C10H10O.HOP/c1-5-4-8-9(10(8)11)7(3)6(5)2;1-2/h4H,1-3H3;2H |
| InChIKey | AUPJBAPOUQETRG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.17 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|