About 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride
2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride (PubChem CID 174600801) has the molecular formula C9H20ClN3O2
and a molecular weight of 237.73 g/mol. Its IUPAC name is 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride |
| PubChem CID | 174600801 |
| Molecular Formula | C9H20ClN3O2 |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride |
| SMILES | C=CCC(C(=O)O)N(CC)CC(N)N.Cl |
| InChI | InChI=1S/C9H19N3O2.ClH/c1-3-5-7(9(13)14)12(4-2)6-8(10)11;/h3,7-8H,1,4-6,10-11H2,2H3,(H,13,14);1H |
| InChIKey | FSZFMTHNEWQVCI-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride?
The IUPAC name of 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride (CID 174600801) is 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride.
What is the SMILES notation for 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride?
The canonical SMILES for 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride is C=CCC(C(=O)O)N(CC)CC(N)N.Cl.
What is the InChIKey of 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride?
The InChIKey is FSZFMTHNEWQVCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O2.ClH/c1-3-5-7(9(13)14)12(4-2)6-8(10)11;/h3,7-8H,1,4-6,10-11H2,2H3,(H,13,14);1H.
What are the key properties of 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride?
2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride has a molecular weight of 237.73 g/mol, XLogP of 0.00, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-diaminoethyl(ethyl)amino]pent-4-enoic acid;hydrochloride is sourced from PubChem (CID 174600801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).