C15H13F3N2O3S — CID 174600822
3-oxo-4-[4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]phenyl]pentanoic acid (PubChem CID 174600822) has the molecular formula C15H13F3N2O3S and a molecular weight of 358.34 g/mol. Its IUPAC name is 3-oxo-4-[4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]phenyl]pentanoic acid.
| Compound Name | 3-oxo-4-[4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 174600822 |
| Molecular Formula | C15H13F3N2O3S |
| Molecular Weight | 358.34 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 3-oxo-4-[4-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]amino]phenyl]pentanoic acid |
| SMILES | CC(C(=O)CC(=O)O)c1ccc(Nc2nc(C(F)(F)F)cs2)cc1 |
| InChI | InChI=1S/C15H13F3N2O3S/c1-8(11(21)6-13(22)23)9-2-4-10(5-3-9)19-14-20-12(7-24-14)15(16,17)18/h2-5,7-8H,6H2,1H3,(H,19,20)(H,22,23) |
| InChIKey | RHBNSXIKWAVKHF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.34 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|