About 5-bromo-1,3-thiazol-2-amine;hydron
5-bromo-1,3-thiazol-2-amine;hydron (PubChem CID 174601727) has the molecular formula C3H4BrN2S+
and a molecular weight of 180.05 g/mol. Its IUPAC name is 5-bromo-1,3-thiazol-2-amine;hydron.
Molecular Properties
| Compound Name | 5-bromo-1,3-thiazol-2-amine;hydron |
| PubChem CID | 174601727 |
| Molecular Formula | C3H4BrN2S+ |
| Molecular Weight | 180.05 g/mol |
| Exact Mass | 178.93 |
| IUPAC Name | 5-bromo-1,3-thiazol-2-amine;hydron |
| SMILES | Nc1ncc(Br)s1.[H+] |
| InChI | InChI=1S/C3H3BrN2S/c4-2-1-6-3(5)7-2/h1H,(H2,5,6)/p+1 |
| InChIKey | ARHCLXWELPFVFQ-UHFFFAOYSA-O |
| XLogP | 1.60 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.05 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-1,3-thiazol-2-amine;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-thiazol-2-amine;hydron?
The IUPAC name of 5-bromo-1,3-thiazol-2-amine;hydron (CID 174601727) is 5-bromo-1,3-thiazol-2-amine;hydron.
What is the SMILES notation for 5-bromo-1,3-thiazol-2-amine;hydron?
The canonical SMILES for 5-bromo-1,3-thiazol-2-amine;hydron is Nc1ncc(Br)s1.[H+].
What is the InChIKey of 5-bromo-1,3-thiazol-2-amine;hydron?
The InChIKey is ARHCLXWELPFVFQ-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H3BrN2S/c4-2-1-6-3(5)7-2/h1H,(H2,5,6)/p+1.
What are the key properties of 5-bromo-1,3-thiazol-2-amine;hydron?
5-bromo-1,3-thiazol-2-amine;hydron has a molecular weight of 180.05 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-thiazol-2-amine;hydron is sourced from PubChem (CID 174601727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).