About [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate
[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate (PubChem CID 174602313) has the molecular formula C11H11ClN4O2S
and a molecular weight of 298.76 g/mol. Its IUPAC name is [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate.
Molecular Properties
| Compound Name | [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate |
| PubChem CID | 174602313 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate |
| SMILES | Cc1nc(Cl)cc(NC(COC=O)c2cncs2)n1 |
| InChI | InChI=1S/C11H11ClN4O2S/c1-7-14-10(12)2-11(15-7)16-8(4-18-6-17)9-3-13-5-19-9/h2-3,5-6,8H,4H2,1H3,(H,14,15,16) |
| InChIKey | ITYHNETVFHPROI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate?
The IUPAC name of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate (CID 174602313) is [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate.
What is the SMILES notation for [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate?
The canonical SMILES for [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate is Cc1nc(Cl)cc(NC(COC=O)c2cncs2)n1.
What is the InChIKey of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate?
The InChIKey is ITYHNETVFHPROI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClN4O2S/c1-7-14-10(12)2-11(15-7)16-8(4-18-6-17)9-3-13-5-19-9/h2-3,5-6,8H,4H2,1H3,(H,14,15,16).
What are the key properties of [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate?
[2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate has a molecular weight of 298.76 g/mol, XLogP of 2.22, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(6-chloro-2-methylpyrimidin-4-yl)amino]-2-(1,3-thiazol-5-yl)ethyl] formate is sourced from PubChem (CID 174602313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).