About [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite
[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite (PubChem CID 174602606) has the molecular formula C12H14NO6S-
and a molecular weight of 300.31 g/mol. Its IUPAC name is [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite.
Molecular Properties
| Compound Name | [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite |
| PubChem CID | 174602606 |
| Molecular Formula | C12H14NO6S- |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite |
| SMILES | O=C(OS(=O)[O-])C1CCC(CN2C(=O)C=CC2=O)CC1 |
| InChI | InChI=1S/C12H15NO6S/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)19-20(17)18/h5-6,8-9H,1-4,7H2,(H,17,18)/p-1 |
| InChIKey | FVPUEJIXRSTWBZ-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite?
The IUPAC name of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite (CID 174602606) is [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite.
What is the SMILES notation for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite?
The canonical SMILES for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite is O=C(OS(=O)[O-])C1CCC(CN2C(=O)C=CC2=O)CC1.
What is the InChIKey of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite?
The InChIKey is FVPUEJIXRSTWBZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H15NO6S/c14-10-5-6-11(15)13(10)7-8-1-3-9(4-2-8)12(16)19-20(17)18/h5-6,8-9H,1-4,7H2,(H,17,18)/p-1.
What are the key properties of [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite?
[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite has a molecular weight of 300.31 g/mol, XLogP of 0.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl] sulfite is sourced from PubChem (CID 174602606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).